Product Information:
| Cat. No.: EX-A11466D | Purity: >98% |
![]() | |
| Chemical structure of 2764998-33-4 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 2764998-33-4 |
|---|---|
| Purity | >98% |
| Formula | C35H48BN5O7S |
| Mol Weight | 693.661 |
| CoA | CoA of 2764998-33-4 |
| Smiles: | CC1(C)CC2=C(NC=3C2=CC(=CC3)C=4N=C(SC4)C[C@H](NC(OC(C)(C)C)=O)C(=O)N5N[C@](C(=O)OC1)(CCC5)[H])B6OC(C)(C)C(C)(C)O6 |
|---|
KEYWORDS: buy 2764998-33-4 | 2764998-33-4 supplier | purchase | cost | manufacturer | order | distributor | buy 2764998-33-4 | 2764998-33-4 supplier


Inhibitor Specialist
