Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A16430Y | Purity: >97% |
 | |
| Chemical structure of 2-Benzoxazolamine, N-(2-methoxyphenyl)- |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 213261-87-1 |
|---|---|
| Purity | >97% |
| Formula | C14H12N2O2 |
| Mol Weight | 240.2573 |
| CoA | CoA of 2-Benzoxazolamine, N-(2-methoxyphenyl)- |
| Smiles: | N1=C(OC=2C=CC=CC12)NC=3C=CC=CC3OC |
|---|
KEYWORDS: buy 2-Benzoxazolamine, N-(2-methoxyphenyl)- | 2-Benzoxazolamine, N-(2-methoxyphenyl)- supplier | purchase | cost | manufacturer | order | distributor | buy 213261-87-1 | 213261-87-1 supplier