Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3579 | Purity: >98% |
 | |
| Chemical structure of 1A-116 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1430208-73-3 |
|---|---|
| Purity | >98% |
| Formula | C16H16F3N3 |
| Mol Weight | 307.3135 |
| CoA | CoA of 1A-116 |
| Smiles: | N=C(NC1=CC=CC=C1C(F)(F)F)NC2=CC(C)=CC(C)=C2 |
|---|
KEYWORDS: buy 1A-116 | 1A-116 supplier | purchase | cost | manufacturer | order | distributor | buy 1430208-73-3 | 1430208-73-3 supplier