Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1085 | Purity: >98% |
 | |
| Chemical structure of (18F)THK-523 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1354653-91-0 |
|---|---|
| Purity | >98% |
| Formula | C17H15FN2O |
| Mol Weight | 282.3122 |
| CoA | CoA of (18F)THK-523 |
| Smiles: | NC1=CC=C(C=C1)C1=NC2=CC=C(OCCF)C=C2C=C1 |
|---|
KEYWORDS: buy (18F)THK-523 | (18F)THK-523 supplier | purchase | cost | manufacturer | order | distributor | buy 1354653-91-0 | 1354653-91-0 supplier