Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3580 | Purity: >98% |
 | |
| Chemical structure of 17-phenyl trinor Prostaglandin F2alpha amide |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | Bimatoprost amide |
|---|---|
| CAS No. | 155205-89-3 |
| Purity | >98% |
| Formula | C23H33NO4 |
| Mol Weight | 387.5124 |
| CoA | CoA of 17-phenyl trinor Prostaglandin F2alpha amide |
| Smiles: | C1[C@@H]([C@@H]([C@H]([C@@H]1O)/C=C/[C@H](CCC2=CC=CC=C2)O)C/C=C\CCCC(=O)N)O |
|---|
KEYWORDS: buy 17-phenyl trinor Prostaglandin F2alpha amide | 17-phenyl trinor Prostaglandin F2alpha amide supplier | purchase | cost | manufacturer | order | distributor | buy 155205-89-3 | 155205-89-3 supplier