Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A13562K | Purity: >95% |
 | |
| Chemical structure of Ethyl 2,3,4-tri-O-benzyl-1-thio-β-D-glucopyranoside |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 126461-54-9 |
|---|---|
| Purity | >95% |
| Formula | C29H34O5S |
| Mol Weight | 494.642 |
| CoA | CoA of Ethyl 2,3,4-tri-O-benzyl-1-thio-β-D-glucopyranoside |
| Smiles: | O(CC1=CC=CC=C1)[C@@H]2[C@@H](OCC3=CC=CC=C3)[C@H](SCC)O[C@H](CO)[C@H]2OCC4=CC=CC=C4 |
|---|
KEYWORDS: buy Ethyl 2,3,4-tri-O-benzyl-1-thio-β-D-glucopyranoside | Ethyl 2,3,4-tri-O-benzyl-1-thio-β-D-glucopyranoside supplier | purchase | cost | manufacturer | order | distributor | buy 126461-54-9 | 126461-54-9 supplier