Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A9654M | Purity: >97% |
 | |
| Chemical structure of 10H-Phenothiazine, 3,7-dichloro- |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1771-23-9 |
|---|---|
| Purity | >97% |
| Formula | C12H7Cl2NS |
| Mol Weight | 268.162 |
| CoA | CoA of 10H-Phenothiazine, 3,7-dichloro- |
| Smiles: | ClC1=CC2=C(NC3=CC=C(Cl)C=C3S2)C=C1 |
|---|
KEYWORDS: buy 10H-Phenothiazine, 3,7-dichloro- | 10H-Phenothiazine, 3,7-dichloro- supplier | purchase | cost | manufacturer | order | distributor | buy 1771-23-9 | 1771-23-9 supplier