Product Information:
| Cat. No.: EX-A9568 | Purity: >98% |
![]() | |
| Chemical structure of (S)-3,4-DCPG |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 201730-11-2 |
|---|---|
| Purity | >98% |
| Formula | C10H9NO6 |
| Mol Weight | 239.1816 |
| CoA | CoA of (S)-3,4-DCPG |
| Smiles: | OC(C1=C(C=CC([C@H](N)C(O)=O)=C1)C(O)=O)=O |
|---|
KEYWORDS: buy (S)-3,4-DCPG | (S)-3,4-DCPG supplier | purchase | cost | manufacturer | order | distributor | buy 201730-11-2 | 201730-11-2 supplier


Inhibitor Specialist
