Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A269 | Purity: >98% |
 | |
| Chemical structure of Dynasore |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 304448-55-3 |
|---|---|
| Purity | >98% |
| Formula | C18H16N2O5 |
| Mol Weight | 340.33 |
| CoA | CoA of Dynasore |
| Smiles: | O.OC1=CC=C(\C=N\NC(=O)C2=C(O)C=C3C=CC=CC3=C2)C=C1O |
|---|
KEYWORDS: buy Dynasore | Dynasore supplier | purchase | cost | manufacturer | order | distributor | buy 304448-55-3 | 304448-55-3 supplier