Product Information:
| Cat. No.: EX-A11157 | Purity: >98% |
![]() | |
| Chemical structure of CBP/p300-IN-5 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | P300/CBP-IN-5 |
|---|---|
| CAS No. | 1889284-33-6 |
| Purity | >98% |
| Formula | C29H27F5N6O4 |
| Mol Weight | 618.5545 |
| CoA | CoA of CBP/p300-IN-5 |
| Smiles: | O=C(CN(C1=O)C(N[C@@]21C[C@H](C3=C2C=CC(C4=CN(N=C4)CC(NC)=O)=C3)F)=O)N([C@H](C(F)(F)F)C)CC5=CC=C(C=C5)F |
|---|
KEYWORDS: buy CBP/p300-IN-5 | CBP/p300-IN-5 supplier | purchase | cost | manufacturer | order | distributor | buy 1889284-33-6 | 1889284-33-6 supplier


Inhibitor Specialist
