Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A9959 | Purity: >98% |
 | |
| Chemical structure of BODIPY 558/568 NHS ester |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 150173-73-2 |
|---|---|
| Purity | >98% |
| Formula | C20H16BF2N3O4S |
| Mol Weight | 443.232 |
| CoA | CoA of BODIPY 558/568 NHS ester |
| Smiles: | O=C(ON1C(=O)CCC1=O)CCC2=CC=C3C=C4C=CC(C=5SC=CC5)=[N]4[B+3]([F-])([F-])[N-]32 |
|---|
KEYWORDS: buy BODIPY 558/568 NHS ester | BODIPY 558/568 NHS ester supplier | purchase | cost | manufacturer | order | distributor | buy 150173-73-2 | 150173-73-2 supplier