Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A674 | Purity: >98% |
 | |
| Chemical structure of GSK269962 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | GSK269962A |
|---|---|
| Synonyms 2 | 925213-63-4 |
| CAS No. | 850664-21-0 |
| Purity | >98% |
| Formula | C29H30N8O5 |
| Mol Weight | 570.5991 |
| CoA | CoA of GSK269962 |
| Smiles: | CCN1C2=CC(OC3=CC=CC(NC(=O)C4=CC=C(OCCN5CCOCC5)C=C4)=C3)=NC=C2N=C1C1=NON=C1N |
|---|
KEYWORDS: buy GSK269962 | GSK269962 supplier | purchase | cost | manufacturer | order | distributor | buy 850664-21-0 | 850664-21-0 supplier