Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A338 | Purity: >98% |
 | |
| Chemical structure of ETP-46464 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1345675-02-6 |
|---|---|
| Purity | >98% |
| Formula | C30H22N4O2 |
| Mol Weight | 470.5213 |
| CoA | CoA of ETP-46464 |
| Smiles: | CC(C)(C#N)C1=CC=C(C=C1)N1C(=O)OCC2=C1C1=CC(=CC=C1N=C2)C1=CC2=CC=CC=C2N=C1 |
|---|
KEYWORDS: buy ETP-46464 | ETP-46464 supplier | purchase | cost | manufacturer | order | distributor | buy 1345675-02-6 | 1345675-02-6 supplier