Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1748 | Purity: >98% |
 | |
| Chemical structure of NB-598 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 131060-14-5 |
|---|---|
| Purity | >98% |
| Formula | C27H31NOS2 |
| Mol Weight | 449.671 |
| CoA | CoA of NB-598 |
| Smiles: | CCN(C\C=C\C#CC(C)(C)C)CC1=CC=CC(OCC2=CC(=CS2)C2=CSC=C2)=C1 |
|---|
KEYWORDS: buy NB-598 | NB-598 supplier | purchase | cost | manufacturer | order | distributor | buy 131060-14-5 | 131060-14-5 supplier