Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A211 | Purity: >98% |
 | |
| Chemical structure of MK4305 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1030377-33-3 |
|---|---|
| Purity | >98% |
| Formula | C23H23ClN6O2 |
| Mol Weight | 450.921 |
| CoA | CoA of MK4305 |
| Smiles: | C[C@@H]1CCN(CCN1C(=O)C1=CC(C)=CC=C1N1N=CC=N1)C1=NC2=CC(Cl)=CC=C2O1 |
|---|
KEYWORDS: buy MK4305 | MK4305 supplier | purchase | cost | manufacturer | order | distributor | buy 1030377-33-3 | 1030377-33-3 supplier